C17H14N4O6 — CID 124775948
(1S,2R,6R,7S,8S,10R)-4-(2,4-dinitroanilino)-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 124775948) has the molecular formula C17H14N4O6 and a molecular weight of 370.32 g/mol. Its IUPAC name is (1S,2R,6R,7S,8S,10R)-4-(2,4-dinitroanilino)-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S,8S,10R)-4-(2,4-dinitroanilino)-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 124775948 |
| Molecular Formula | C17H14N4O6 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (1S,2R,6R,7S,8S,10R)-4-(2,4-dinitroanilino)-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@H]34)[C@H]2C(=O)N1Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N4O6/c22-16-14-8-2-3-9(11-6-10(8)11)15(14)17(23)19(16)18-12-4-1-7(20(24)25)5-13(12)21(26)27/h1-5,8-11,14-15,18H,6H2/t8-,9-,10-,11+,14+,15+/m0/s1 |
| InChIKey | SNVLJRBUBUBHBJ-AJABAVSMSA-N |
| XLogP | 1.88 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|