C23H18N8O8 — CID 124772229
N-[(Z)-[(1S,2R,3S,5R,6R,7S,9S,10R,11Z)-11-[(2,4-dinitrophenyl)hydrazinylidene]-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]amino]-2,4-dinitroaniline (PubChem CID 124772229) has the molecular formula C23H18N8O8 and a molecular weight of 534.45 g/mol. Its IUPAC name is N-[(Z)-[(1S,2R,3S,5R,6R,7S,9S,10R,11Z)-11-[(2,4-dinitrophenyl)hydrazinylidene]-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-[(1S,2R,3S,5R,6R,7S,9S,10R,11Z)-11-[(2,4-dinitrophenyl)hydrazinylidene]-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 124772229 |
| Molecular Formula | C23H18N8O8 |
| Molecular Weight | 534.45 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | N-[(Z)-[(1S,2R,3S,5R,6R,7S,9S,10R,11Z)-11-[(2,4-dinitrophenyl)hydrazinylidene]-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]amino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C2/[C@@H]3[C@H]4C[C@H]5[C@@H]3/C(=N/Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])[C@@H]3[C@@H]2[C@H]4[C@@H]53)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H18N8O8/c32-28(33)8-1-3-12(14(5-8)30(36)37)24-26-22-18-10-7-11-17-16(10)20(22)21(17)23(19(11)18)27-25-13-4-2-9(29(34)35)6-15(13)31(38)39/h1-6,10-11,16-21,24-25H,7H2/b26-22-,27-23-/t10-,11+,16-,17-,18+,19-,20+,21+/m1/s1 |
| InChIKey | MPIVYDLQRSARCW-WORNMFRFSA-N |
| XLogP | 3.94 |
| TPSA | 221.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|