C17H15IN4O4 — CID 99844929
N-[(E)-[(1S,2S,3S,5S,6R,7R,8S,9R,10S)-7-iodo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]-2,4-dinitroaniline (PubChem CID 99844929) has the molecular formula C17H15IN4O4 and a molecular weight of 466.24 g/mol. Its IUPAC name is N-[(E)-[(1S,2S,3S,5S,6R,7R,8S,9R,10S)-7-iodo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[(1S,2S,3S,5S,6R,7R,8S,9R,10S)-7-iodo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 99844929 |
| Molecular Formula | C17H15IN4O4 |
| Molecular Weight | 466.24 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | N-[(E)-[(1S,2S,3S,5S,6R,7R,8S,9R,10S)-7-iodo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C2/[C@H]3[C@H]4[C@@H]5C[C@@H]6[C@@H]4[C@@H](I)[C@@H]3[C@@H]6[C@@H]25)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15IN4O4/c18-16-12-6-4-7-10(12)15-14(16)11(6)13(7)17(15)20-19-8-2-1-5(21(23)24)3-9(8)22(25)26/h1-3,6-7,10-16,19H,4H2/b20-17+/t6-,7-,10-,11-,12-,13-,14+,15-,16+/m0/s1 |
| InChIKey | ONQRMRLNRDSIAF-JLMWICBISA-N |
| XLogP | 3.46 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|