C13H14N4O5 — CID 90481939
2,4-dinitro-N-[(Z)-3-oxabicyclo[5.1.0]octan-6-ylideneamino]aniline (PubChem CID 90481939) has the molecular formula C13H14N4O5 and a molecular weight of 306.28 g/mol. Its IUPAC name is 2,4-dinitro-N-[(Z)-3-oxabicyclo[5.1.0]octan-6-ylideneamino]aniline.
| Compound Name | 2,4-dinitro-N-[(Z)-3-oxabicyclo[5.1.0]octan-6-ylideneamino]aniline |
|---|---|
| PubChem CID | 90481939 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2,4-dinitro-N-[(Z)-3-oxabicyclo[5.1.0]octan-6-ylideneamino]aniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C2/CCOCC3CC23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14N4O5/c18-16(19)9-1-2-12(13(6-9)17(20)21)15-14-11-3-4-22-7-8-5-10(8)11/h1-2,6,8,10,15H,3-5,7H2/b14-11- |
| InChIKey | IMXOTQRSZROVDG-KAMYIIQDSA-N |
| XLogP | 2.33 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|