C14H16N4O6S — CID 6610708
2-[2-[(2,4-dinitrophenyl)hydrazinylidene]cyclohexyl]sulfanylacetic acid (PubChem CID 6610708) has the molecular formula C14H16N4O6S and a molecular weight of 368.37 g/mol. Its IUPAC name is 2-[2-[(2,4-dinitrophenyl)hydrazinylidene]cyclohexyl]sulfanylacetic acid.
| Compound Name | 2-[2-[(2,4-dinitrophenyl)hydrazinylidene]cyclohexyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 6610708 |
| Molecular Formula | C14H16N4O6S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-[2-[(2,4-dinitrophenyl)hydrazinylidene]cyclohexyl]sulfanylacetic acid |
| SMILES | O=C(O)CSC1CCCCC1=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N4O6S/c19-14(20)8-25-13-4-2-1-3-11(13)16-15-10-6-5-9(17(21)22)7-12(10)18(23)24/h5-7,13,15H,1-4,8H2,(H,19,20) |
| InChIKey | BWDZQBFGJQBJFT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|