C28H28N8O8 — CID 6834381
N-[[7-[(2,4-dinitrophenyl)hydrazinylidene]-6-bicyclo[10.2.2]hexadeca-1(14),12,15-trienylidene]amino]-2,4-dinitroaniline (PubChem CID 6834381) has the molecular formula C28H28N8O8 and a molecular weight of 604.58 g/mol. Its IUPAC name is N-[[7-[(2,4-dinitrophenyl)hydrazinylidene]-6-bicyclo[10.2.2]hexadeca-1(14),12,15-trienylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[[7-[(2,4-dinitrophenyl)hydrazinylidene]-6-bicyclo[10.2.2]hexadeca-1(14),12,15-trienylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 6834381 |
| Molecular Formula | C28H28N8O8 |
| Molecular Weight | 604.58 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | N-[[7-[(2,4-dinitrophenyl)hydrazinylidene]-6-bicyclo[10.2.2]hexadeca-1(14),12,15-trienylidene]amino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(NN=C2CCCCc3ccc(cc3)CCCCC2=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H28N8O8/c37-33(38)21-13-15-25(27(17-21)35(41)42)31-29-23-7-3-1-5-19-9-11-20(12-10-19)6-2-4-8-24(23)30-32-26-16-14-22(34(39)40)18-28(26)36(43)44/h9-18,31-32H,1-8H2 |
| InChIKey | LWPPLBPOQXGZFI-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 221.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.58 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|