C17H16N4O4 — CID 90482633
2,4-dinitro-N-[(E)-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylideneamino]aniline (PubChem CID 90482633) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2,4-dinitro-N-[(E)-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylideneamino]aniline.
| Compound Name | 2,4-dinitro-N-[(E)-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylideneamino]aniline |
|---|---|
| PubChem CID | 90482633 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2,4-dinitro-N-[(E)-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylideneamino]aniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C2\CCCc3ccccc3C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N4O4/c22-20(23)15-8-9-16(17(11-15)21(24)25)19-18-14-7-3-6-12-4-1-2-5-13(12)10-14/h1-2,4-5,8-9,11,19H,3,6-7,10H2/b18-14+ |
| InChIKey | JVOZWVFVPPEZKP-NBVRZTHBSA-N |
| XLogP | 3.85 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|