C18H18N4O4 — CID 102504507
2,4-dinitro-N-[(Z)-(3-phenylcyclohexylidene)amino]aniline (PubChem CID 102504507) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2,4-dinitro-N-[(Z)-(3-phenylcyclohexylidene)amino]aniline.
| Compound Name | 2,4-dinitro-N-[(Z)-(3-phenylcyclohexylidene)amino]aniline |
|---|---|
| PubChem CID | 102504507 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2,4-dinitro-N-[(Z)-(3-phenylcyclohexylidene)amino]aniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C2/CCCC(c3ccccc3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N4O4/c23-21(24)16-9-10-17(18(12-16)22(25)26)20-19-15-8-4-7-14(11-15)13-5-2-1-3-6-13/h1-3,5-6,9-10,12,14,20H,4,7-8,11H2/b19-15- |
| InChIKey | ZXNCPWKPZJWKJD-CYVLTUHYSA-N |
| XLogP | 4.63 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|