C18H20ClN5O4 — CID 74257084
N-[(1-methyl-3-phenylpiperidin-4-ylidene)amino]-2,4-dinitroaniline;hydrochloride (PubChem CID 74257084) has the molecular formula C18H20ClN5O4 and a molecular weight of 405.84 g/mol. Its IUPAC name is N-[(1-methyl-3-phenylpiperidin-4-ylidene)amino]-2,4-dinitroaniline;hydrochloride.
| Compound Name | N-[(1-methyl-3-phenylpiperidin-4-ylidene)amino]-2,4-dinitroaniline;hydrochloride |
|---|---|
| PubChem CID | 74257084 |
| Molecular Formula | C18H20ClN5O4 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-[(1-methyl-3-phenylpiperidin-4-ylidene)amino]-2,4-dinitroaniline;hydrochloride |
| SMILES | CN1CCC(=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(c2ccccc2)C1.Cl |
| InChI | InChI=1S/C18H19N5O4.ClH/c1-21-10-9-16(15(12-21)13-5-3-2-4-6-13)19-20-17-8-7-14(22(24)25)11-18(17)23(26)27;/h2-8,11,15,20H,9-10,12H2,1H3;1H |
| InChIKey | GUPDUXROARNKLC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|