C19H17N4O6- — CID 7335896
trans-(1S,2S,3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]-2-methyl-1-phenylcyclopentane-1-carboxylate (PubChem CID 7335896) has the molecular formula C19H17N4O6- and a molecular weight of 397.37 g/mol. Its IUPAC name is trans-(1S,2S,3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]-2-methyl-1-phenylcyclopentane-1-carboxylate.
| Compound Name | trans-(1S,2S,3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]-2-methyl-1-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 7335896 |
| Molecular Formula | C19H17N4O6- |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | trans-(1S,2S,3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]-2-methyl-1-phenylcyclopentane-1-carboxylate |
| SMILES | C[C@@H]1/C(=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC[C@@]1(C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C19H18N4O6/c1-12-15(9-10-19(12,18(24)25)13-5-3-2-4-6-13)20-21-16-8-7-14(22(26)27)11-17(16)23(28)29/h2-8,11-12,21H,9-10H2,1H3,(H,24,25)/p-1/b20-15+/t12-,19+/m1/s1 |
| InChIKey | GZBLEGZPSIEDSO-XHHPGNNLSA-M |
| XLogP | 2.39 |
| TPSA | 150.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|