C19H26N4O4 — CID 20845766
2,4-dinitro-N-[(E)-[(8S)-5,5,8-trimethyl-2,3,4,4a,6,7,8,8a-octahydronaphthalen-1-ylidene]amino]aniline (PubChem CID 20845766) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2,4-dinitro-N-[(E)-[(8S)-5,5,8-trimethyl-2,3,4,4a,6,7,8,8a-octahydronaphthalen-1-ylidene]amino]aniline.
| Compound Name | 2,4-dinitro-N-[(E)-[(8S)-5,5,8-trimethyl-2,3,4,4a,6,7,8,8a-octahydronaphthalen-1-ylidene]amino]aniline |
|---|---|
| PubChem CID | 20845766 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2,4-dinitro-N-[(E)-[(8S)-5,5,8-trimethyl-2,3,4,4a,6,7,8,8a-octahydronaphthalen-1-ylidene]amino]aniline |
| SMILES | C[C@H]1CCC(C)(C)C2CCC/C(=N\Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])C21 |
| InChI | InChI=1S/C19H26N4O4/c1-12-9-10-19(2,3)14-5-4-6-16(18(12)14)21-20-15-8-7-13(22(24)25)11-17(15)23(26)27/h7-8,11-12,14,18,20H,4-6,9-10H2,1-3H3/b21-16+/t12-,14?,18?/m0/s1 |
| InChIKey | QNCMQRMVSNOVGB-AYOOQVKESA-N |
| XLogP | 5.14 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|