C16H20N4O4 — CID 7188935
2,4-dinitro-N-[(Z)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]aniline (PubChem CID 7188935) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2,4-dinitro-N-[(Z)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]aniline.
| Compound Name | 2,4-dinitro-N-[(Z)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]aniline |
|---|---|
| PubChem CID | 7188935 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2,4-dinitro-N-[(Z)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]aniline |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)/C(=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C16H20N4O4/c1-15(2)10-6-7-16(15,3)14(8-10)18-17-12-5-4-11(19(21)22)9-13(12)20(23)24/h4-5,9-10,17H,6-8H2,1-3H3/b18-14-/t10-,16+/m1/s1 |
| InChIKey | NMBKAYQOVKPVRQ-SWPSMJOTSA-N |
| XLogP | 4.12 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|