C25H34N4O5 — CID 20845943
(3R,5R,8R,9S,10S,13S,14S,17Z)-17-[(2,4-dinitrophenyl)hydrazinylidene]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 20845943) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is (3R,5R,8R,9S,10S,13S,14S,17Z)-17-[(2,4-dinitrophenyl)hydrazinylidene]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5R,8R,9S,10S,13S,14S,17Z)-17-[(2,4-dinitrophenyl)hydrazinylidene]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 20845943 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | (3R,5R,8R,9S,10S,13S,14S,17Z)-17-[(2,4-dinitrophenyl)hydrazinylidene]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@@H](O)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)/C(=N\Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])CC[C@@H]12 |
| InChI | InChI=1S/C25H34N4O5/c1-24-11-9-17(30)13-15(24)3-5-18-19-6-8-23(25(19,2)12-10-20(18)24)27-26-21-7-4-16(28(31)32)14-22(21)29(33)34/h4,7,14-15,17-20,26,30H,3,5-6,8-13H2,1-2H3/b27-23-/t15-,17-,18+,19+,20+,24+,25+/m1/s1 |
| InChIKey | FTLREWFXBTYMQV-DBBCMMSQSA-N |
| XLogP | 5.67 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|