C29H44N2O — CID 10670593
(3R,8S,9S,10S,13S,14S,17E)-17-[(4-tert-butylphenyl)hydrazinylidene]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 10670593) has the molecular formula C29H44N2O and a molecular weight of 436.68 g/mol. Its IUPAC name is (3R,8S,9S,10S,13S,14S,17E)-17-[(4-tert-butylphenyl)hydrazinylidene]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,8S,9S,10S,13S,14S,17E)-17-[(4-tert-butylphenyl)hydrazinylidene]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 10670593 |
| Molecular Formula | C29H44N2O |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.35 |
| IUPAC Name | (3R,8S,9S,10S,13S,14S,17E)-17-[(4-tert-butylphenyl)hydrazinylidene]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)(C)c1ccc(N/N=C2\CC[C@H]3[C@H]4CCC5C[C@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C29H44N2O/c1-27(2,3)19-6-9-21(10-7-19)30-31-26-13-12-24-23-11-8-20-18-22(32)14-16-28(20,4)25(23)15-17-29(24,26)5/h6-7,9-10,20,22-25,30,32H,8,11-18H2,1-5H3/b31-26+/t20?,22-,23-,24+,25+,28+,29+/m1/s1 |
| InChIKey | ORIOYEIPCVHRRZ-CCPJNKITSA-N |
| XLogP | 7.16 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|