C29H34N8O8 — CID 45044026
N-[(Z)-[3-[N-(2,4-dinitroanilino)-C-methylcarbonimidoyl]-3a,6-dimethyl-2,3,4,5,5a,6,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-7-ylidene]amino]-2,4-dinitroaniline (PubChem CID 45044026) has the molecular formula C29H34N8O8 and a molecular weight of 622.64 g/mol. Its IUPAC name is N-[(Z)-[3-[N-(2,4-dinitroanilino)-C-methylcarbonimidoyl]-3a,6-dimethyl-2,3,4,5,5a,6,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-7-ylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-[3-[N-(2,4-dinitroanilino)-C-methylcarbonimidoyl]-3a,6-dimethyl-2,3,4,5,5a,6,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-7-ylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 45044026 |
| Molecular Formula | C29H34N8O8 |
| Molecular Weight | 622.64 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | N-[(Z)-[3-[N-(2,4-dinitroanilino)-C-methylcarbonimidoyl]-3a,6-dimethyl-2,3,4,5,5a,6,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-7-ylidene]amino]-2,4-dinitroaniline |
| SMILES | CC(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C1CCC2C3CC/C(=N/Nc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])C(C)C3CCC12C |
| InChI | InChI=1S/C29H34N8O8/c1-16-20-12-13-29(3)22(17(2)30-32-25-9-4-18(34(38)39)14-27(25)36(42)43)7-8-23(29)21(20)6-11-24(16)31-33-26-10-5-19(35(40)41)15-28(26)37(44)45/h4-5,9-10,14-16,20-23,32-33H,6-8,11-13H2,1-3H3/b30-17?,31-24- |
| InChIKey | HPOQPAMETPEUQL-KTLQHVSCSA-N |
| XLogP | 7.06 |
| TPSA | 221.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.64 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|