C17H20N4O8 — CID 7159531
cis-(1R,3R)-3-[C-carboxy-N-(2,4-dinitroanilino)carbonimidoyl]-2,2,3-trimethylcyclopentane-1-carboxylic acid (PubChem CID 7159531) has the molecular formula C17H20N4O8 and a molecular weight of 408.37 g/mol. Its IUPAC name is cis-(1R,3R)-3-[C-carboxy-N-(2,4-dinitroanilino)carbonimidoyl]-2,2,3-trimethylcyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3R)-3-[C-carboxy-N-(2,4-dinitroanilino)carbonimidoyl]-2,2,3-trimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 7159531 |
| Molecular Formula | C17H20N4O8 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | cis-(1R,3R)-3-[C-carboxy-N-(2,4-dinitroanilino)carbonimidoyl]-2,2,3-trimethylcyclopentane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)CC[C@@]1(C)C(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C17H20N4O8/c1-16(2)10(14(22)23)6-7-17(16,3)13(15(24)25)19-18-11-5-4-9(20(26)27)8-12(11)21(28)29/h4-5,8,10,18H,6-7H2,1-3H3,(H,22,23)(H,24,25)/t10-,17-/m0/s1 |
| InChIKey | SRVFKTQXNGPLQT-BTDLBPIBSA-N |
| XLogP | 2.88 |
| TPSA | 185.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|