C24H22N8O8 — CID 138977336
N-[(E)-[(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3,3-dimethyl-4-phenylbutylidene]amino]-2,4-dinitroaniline (PubChem CID 138977336) has the molecular formula C24H22N8O8 and a molecular weight of 550.49 g/mol. Its IUPAC name is N-[(E)-[(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3,3-dimethyl-4-phenylbutylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3,3-dimethyl-4-phenylbutylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 138977336 |
| Molecular Formula | C24H22N8O8 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | N-[(E)-[(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3,3-dimethyl-4-phenylbutylidene]amino]-2,4-dinitroaniline |
| SMILES | CC(C)(C/C=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C24H22N8O8/c1-24(2,12-13-25-26-19-10-8-17(29(33)34)14-21(19)31(37)38)23(16-6-4-3-5-7-16)28-27-20-11-9-18(30(35)36)15-22(20)32(39)40/h3-11,13-15,26-27H,12H2,1-2H3/b25-13+,28-23+ |
| InChIKey | SKSLGXCSTWFWMZ-HLQVEFCUSA-N |
| XLogP | 5.65 |
| TPSA | 221.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|