C14H10N6O4 — CID 134094258
N-[(Z)-(2-diazo-1-phenylethylidene)amino]-2,4-dinitroaniline (PubChem CID 134094258) has the molecular formula C14H10N6O4 and a molecular weight of 326.27 g/mol. Its IUPAC name is N-[(Z)-(2-diazo-1-phenylethylidene)amino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-(2-diazo-1-phenylethylidene)amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 134094258 |
| Molecular Formula | C14H10N6O4 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[(Z)-(2-diazo-1-phenylethylidene)amino]-2,4-dinitroaniline |
| SMILES | [N-]=[N+]=C/C(=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C14H10N6O4/c15-16-9-13(10-4-2-1-3-5-10)18-17-12-7-6-11(19(21)22)8-14(12)20(23)24/h1-9,17H/b18-13+ |
| InChIKey | BLKOIYGUUHDYDO-QGOAFFKASA-N |
| XLogP | 2.62 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|