C18H17N7O4 — CID 4618827
N-[[(1-azidocyclopentyl)-phenylmethylidene]amino]-2,4-dinitroaniline (PubChem CID 4618827) has the molecular formula C18H17N7O4 and a molecular weight of 395.38 g/mol. Its IUPAC name is N-[[(1-azidocyclopentyl)-phenylmethylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[[(1-azidocyclopentyl)-phenylmethylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 4618827 |
| Molecular Formula | C18H17N7O4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[[(1-azidocyclopentyl)-phenylmethylidene]amino]-2,4-dinitroaniline |
| SMILES | [N-]=[N+]=NC1(C(=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccccc2)CCCC1 |
| InChI | InChI=1S/C18H17N7O4/c19-23-22-18(10-4-5-11-18)17(13-6-2-1-3-7-13)21-20-15-9-8-14(24(26)27)12-16(15)25(28)29/h1-3,6-9,12,20H,4-5,10-11H2 |
| InChIKey | LAYKEOXACZKZND-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 159.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|