C17H12N6O7 — CID 135832505
5-[(E)-N-(2,4-dinitroanilino)-C-phenylcarbonimidoyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 135832505) has the molecular formula C17H12N6O7 and a molecular weight of 412.32 g/mol. Its IUPAC name is 5-[(E)-N-(2,4-dinitroanilino)-C-phenylcarbonimidoyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(E)-N-(2,4-dinitroanilino)-C-phenylcarbonimidoyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135832505 |
| Molecular Formula | C17H12N6O7 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 5-[(E)-N-(2,4-dinitroanilino)-C-phenylcarbonimidoyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(/C(=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H12N6O7/c24-15-13(16(25)19-17(26)18-15)14(9-4-2-1-3-5-9)21-20-11-7-6-10(22(27)28)8-12(11)23(29)30/h1-8,20H,(H3,18,19,24,25,26)/b21-14+ |
| InChIKey | WEWBXUOPDZAGDM-KGENOOAVSA-N |
| XLogP | 1.45 |
| TPSA | 196.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|