C23H18N4O8 — CID 10874466
[4-[C-(4-acetyloxyphenyl)-N-(2,4-dinitroanilino)carbonimidoyl]phenyl] acetate (PubChem CID 10874466) has the molecular formula C23H18N4O8 and a molecular weight of 478.42 g/mol. Its IUPAC name is [4-[C-(4-acetyloxyphenyl)-N-(2,4-dinitroanilino)carbonimidoyl]phenyl] acetate.
| Compound Name | [4-[C-(4-acetyloxyphenyl)-N-(2,4-dinitroanilino)carbonimidoyl]phenyl] acetate |
|---|---|
| PubChem CID | 10874466 |
| Molecular Formula | C23H18N4O8 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | [4-[C-(4-acetyloxyphenyl)-N-(2,4-dinitroanilino)carbonimidoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccc(OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C23H18N4O8/c1-14(28)34-19-8-3-16(4-9-19)23(17-5-10-20(11-6-17)35-15(2)29)25-24-21-12-7-18(26(30)31)13-22(21)27(32)33/h3-13,24H,1-2H3 |
| InChIKey | MDIWAHHFBOFDLQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 163.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|