C18H19N5O5 — CID 143553064
4-[(Z)-N-(2,4-dinitroanilino)-C-phenylcarbonimidoyl]piperidin-4-ol (PubChem CID 143553064) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 4-[(Z)-N-(2,4-dinitroanilino)-C-phenylcarbonimidoyl]piperidin-4-ol.
| Compound Name | 4-[(Z)-N-(2,4-dinitroanilino)-C-phenylcarbonimidoyl]piperidin-4-ol |
|---|---|
| PubChem CID | 143553064 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-[(Z)-N-(2,4-dinitroanilino)-C-phenylcarbonimidoyl]piperidin-4-ol |
| SMILES | O=[N+]([O-])c1ccc(N/N=C(/c2ccccc2)C2(O)CCNCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N5O5/c24-18(8-10-19-11-9-18)17(13-4-2-1-3-5-13)21-20-15-7-6-14(22(25)26)12-16(15)23(27)28/h1-7,12,19-20,24H,8-11H2/b21-17- |
| InChIKey | FNJTVNRBCVXSSZ-FXBPSFAMSA-N |
| XLogP | 2.43 |
| TPSA | 142.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|