C18H15N5O6 — CID 135832516
6-hydroxy-5-[(E)-C-(4-methoxyphenyl)-N-(4-nitroanilino)carbonimidoyl]-1H-pyrimidine-2,4-dione (PubChem CID 135832516) has the molecular formula C18H15N5O6 and a molecular weight of 397.35 g/mol. Its IUPAC name is 6-hydroxy-5-[(E)-C-(4-methoxyphenyl)-N-(4-nitroanilino)carbonimidoyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(E)-C-(4-methoxyphenyl)-N-(4-nitroanilino)carbonimidoyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135832516 |
| Molecular Formula | C18H15N5O6 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 6-hydroxy-5-[(E)-C-(4-methoxyphenyl)-N-(4-nitroanilino)carbonimidoyl]-1H-pyrimidine-2,4-dione |
| SMILES | COc1ccc(/C(=N\Nc2ccc([N+](=O)[O-])cc2)c2c(O)[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H15N5O6/c1-29-13-8-2-10(3-9-13)15(14-16(24)19-18(26)20-17(14)25)22-21-11-4-6-12(7-5-11)23(27)28/h2-9,21H,1H3,(H3,19,20,24,25,26)/b22-15+ |
| InChIKey | HMHGXXNDFTUBEI-PXLXIMEGSA-N |
| XLogP | 1.55 |
| TPSA | 162.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|