C17H13N3O6 — CID 176509093
4-hydroxy-N-(4-methoxyphenyl)-6-nitro-2-oxo-1H-quinoline-3-carboxamide (PubChem CID 176509093) has the molecular formula C17H13N3O6 and a molecular weight of 355.31 g/mol. Its IUPAC name is 4-hydroxy-N-(4-methoxyphenyl)-6-nitro-2-oxo-1H-quinoline-3-carboxamide.
| Compound Name | 4-hydroxy-N-(4-methoxyphenyl)-6-nitro-2-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 176509093 |
| Molecular Formula | C17H13N3O6 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 4-hydroxy-N-(4-methoxyphenyl)-6-nitro-2-oxo-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(O)c3cc([N+](=O)[O-])ccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H13N3O6/c1-26-11-5-2-9(3-6-11)18-16(22)14-15(21)12-8-10(20(24)25)4-7-13(12)19-17(14)23/h2-8H,1H3,(H,18,22)(H2,19,21,23) |
| InChIKey | RSKWQDZOSWCSMG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|