C19H18N2O4S — CID 123602296
4-(hydroxymethyl)-N-(4-methoxyphenyl)-6-methylsulfanyl-2-oxo-1H-quinoline-3-carboxamide (PubChem CID 123602296) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-(4-methoxyphenyl)-6-methylsulfanyl-2-oxo-1H-quinoline-3-carboxamide.
| Compound Name | 4-(hydroxymethyl)-N-(4-methoxyphenyl)-6-methylsulfanyl-2-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 123602296 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 4-(hydroxymethyl)-N-(4-methoxyphenyl)-6-methylsulfanyl-2-oxo-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(CO)c3cc(SC)ccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-25-12-5-3-11(4-6-12)20-18(23)17-15(10-22)14-9-13(26-2)7-8-16(14)21-19(17)24/h3-9,22H,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | YHDCMBKONBGXCV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |