C14H18N4O4 — CID 98513137
N-[(E)-[(2S)-2-ethylcyclohexylidene]amino]-2,4-dinitroaniline (PubChem CID 98513137) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is N-[(E)-[(2S)-2-ethylcyclohexylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[(2S)-2-ethylcyclohexylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 98513137 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | N-[(E)-[(2S)-2-ethylcyclohexylidene]amino]-2,4-dinitroaniline |
| SMILES | CC[C@H]1CCCC/C1=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N4O4/c1-2-10-5-3-4-6-12(10)15-16-13-8-7-11(17(19)20)9-14(13)18(21)22/h7-10,16H,2-6H2,1H3/b15-12+/t10-/m0/s1 |
| InChIKey | GAJKYALZJYWNTK-PTFXAJSMSA-N |
| XLogP | 3.87 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|