C24H24N4O4 — CID 54608470
N-[(E)-(4-ethyl-5,8-dimethyl-3,4-dihydro-2H-phenanthren-1-ylidene)amino]-2,4-dinitroaniline (PubChem CID 54608470) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-[(E)-(4-ethyl-5,8-dimethyl-3,4-dihydro-2H-phenanthren-1-ylidene)amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-(4-ethyl-5,8-dimethyl-3,4-dihydro-2H-phenanthren-1-ylidene)amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 54608470 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-[(E)-(4-ethyl-5,8-dimethyl-3,4-dihydro-2H-phenanthren-1-ylidene)amino]-2,4-dinitroaniline |
| SMILES | CCC1CC/C(=N\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccc3c(C)ccc(C)c3c21 |
| InChI | InChI=1S/C24H24N4O4/c1-4-16-7-11-20(19-10-9-18-14(2)5-6-15(3)23(18)24(16)19)25-26-21-12-8-17(27(29)30)13-22(21)28(31)32/h5-6,8-10,12-13,16,26H,4,7,11H2,1-3H3/b25-20+ |
| InChIKey | ZASYPLFQBLFUIG-LKUDQCMESA-N |
| XLogP | 6.38 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|