C16H15N5O4 — CID 165344798
N-[(8-methyl-2,3-dihydro-1H-quinolin-4-ylidene)amino]-2,4-dinitroaniline (PubChem CID 165344798) has the molecular formula C16H15N5O4 and a molecular weight of 341.33 g/mol. Its IUPAC name is N-[(8-methyl-2,3-dihydro-1H-quinolin-4-ylidene)amino]-2,4-dinitroaniline.
| Compound Name | N-[(8-methyl-2,3-dihydro-1H-quinolin-4-ylidene)amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 165344798 |
| Molecular Formula | C16H15N5O4 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[(8-methyl-2,3-dihydro-1H-quinolin-4-ylidene)amino]-2,4-dinitroaniline |
| SMILES | Cc1cccc2c1NCCC2=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15N5O4/c1-10-3-2-4-12-13(7-8-17-16(10)12)18-19-14-6-5-11(20(22)23)9-15(14)21(24)25/h2-6,9,17,19H,7-8H2,1H3 |
| InChIKey | LXKHRUQQHQLLSF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|