C19H12N4O5S — CID 10982424
2,4-dinitro-N-[(10-oxothioxanthen-9-ylidene)amino]aniline (PubChem CID 10982424) has the molecular formula C19H12N4O5S and a molecular weight of 408.40 g/mol. Its IUPAC name is 2,4-dinitro-N-[(10-oxothioxanthen-9-ylidene)amino]aniline.
| Compound Name | 2,4-dinitro-N-[(10-oxothioxanthen-9-ylidene)amino]aniline |
|---|---|
| PubChem CID | 10982424 |
| Molecular Formula | C19H12N4O5S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 2,4-dinitro-N-[(10-oxothioxanthen-9-ylidene)amino]aniline |
| SMILES | O=[N+]([O-])c1ccc(NN=C2c3ccccc3S(=O)c3ccccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12N4O5S/c24-22(25)12-9-10-15(16(11-12)23(26)27)20-21-19-13-5-1-3-7-17(13)29(28)18-8-4-2-6-14(18)19/h1-11,20H/b21-19- |
| InChIKey | SLVTWFQJLBVRRZ-VZCXRCSSSA-N |
| XLogP | 3.85 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|