C19H12N4O6 — CID 135962076
9-[(2,4-dinitrophenyl)hydrazinylidene]fluorene-2,4-diol (PubChem CID 135962076) has the molecular formula C19H12N4O6 and a molecular weight of 392.33 g/mol. Its IUPAC name is 9-[(2,4-dinitrophenyl)hydrazinylidene]fluorene-2,4-diol.
| Compound Name | 9-[(2,4-dinitrophenyl)hydrazinylidene]fluorene-2,4-diol |
|---|---|
| PubChem CID | 135962076 |
| Molecular Formula | C19H12N4O6 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 9-[(2,4-dinitrophenyl)hydrazinylidene]fluorene-2,4-diol |
| SMILES | O=[N+]([O-])c1ccc(NN=C2c3ccccc3-c3c(O)cc(O)cc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12N4O6/c24-11-8-14-18(17(25)9-11)12-3-1-2-4-13(12)19(14)21-20-15-6-5-10(22(26)27)7-16(15)23(28)29/h1-9,20,24-25H |
| InChIKey | YFKHYLKKUOPIFD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 151.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|