C26H18N4O4S — CID 6165490
N-[(E)-(3,3-diphenyl-2-benzothiophen-1-ylidene)amino]-2,4-dinitroaniline (PubChem CID 6165490) has the molecular formula C26H18N4O4S and a molecular weight of 482.52 g/mol. Its IUPAC name is N-[(E)-(3,3-diphenyl-2-benzothiophen-1-ylidene)amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-(3,3-diphenyl-2-benzothiophen-1-ylidene)amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 6165490 |
| Molecular Formula | C26H18N4O4S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | N-[(E)-(3,3-diphenyl-2-benzothiophen-1-ylidene)amino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C2/SC(c3ccccc3)(c3ccccc3)c3ccccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H18N4O4S/c31-29(32)20-15-16-23(24(17-20)30(33)34)27-28-25-21-13-7-8-14-22(21)26(35-25,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17,27H/b28-25+ |
| InChIKey | CEWFBBJGGANJLM-AZPGRJICSA-N |
| XLogP | 6.32 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|