C18H16N6O7 — CID 3089481
4-[(2,4-dinitrophenyl)hydrazinylidene]-3a,8b-dihydroxy-1,3-dimethylindeno[1,2-d]imidazol-2-one (PubChem CID 3089481) has the molecular formula C18H16N6O7 and a molecular weight of 428.36 g/mol. Its IUPAC name is 4-[(2,4-dinitrophenyl)hydrazinylidene]-3a,8b-dihydroxy-1,3-dimethylindeno[1,2-d]imidazol-2-one.
| Compound Name | 4-[(2,4-dinitrophenyl)hydrazinylidene]-3a,8b-dihydroxy-1,3-dimethylindeno[1,2-d]imidazol-2-one |
|---|---|
| PubChem CID | 3089481 |
| Molecular Formula | C18H16N6O7 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 4-[(2,4-dinitrophenyl)hydrazinylidene]-3a,8b-dihydroxy-1,3-dimethylindeno[1,2-d]imidazol-2-one |
| SMILES | CN1C(=O)N(C)C2(O)c3ccccc3C(=NNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])C12O |
| InChI | InChI=1S/C18H16N6O7/c1-21-16(25)22(2)18(27)15(11-5-3-4-6-12(11)17(18,21)26)20-19-13-8-7-10(23(28)29)9-14(13)24(30)31/h3-9,19,26-27H,1-2H3 |
| InChIKey | FBLGRDBPYWFAER-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 174.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|