C13H15N5O4 — CID 135822555
(3E,4E)-4-hydroxyimino-1,5,5-trimethyl-3-[(2-nitrophenyl)hydrazinylidene]pyrrolidin-2-one (PubChem CID 135822555) has the molecular formula C13H15N5O4 and a molecular weight of 305.29 g/mol. Its IUPAC name is (3E,4E)-4-hydroxyimino-1,5,5-trimethyl-3-[(2-nitrophenyl)hydrazinylidene]pyrrolidin-2-one.
| Compound Name | (3E,4E)-4-hydroxyimino-1,5,5-trimethyl-3-[(2-nitrophenyl)hydrazinylidene]pyrrolidin-2-one |
|---|---|
| PubChem CID | 135822555 |
| Molecular Formula | C13H15N5O4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (3E,4E)-4-hydroxyimino-1,5,5-trimethyl-3-[(2-nitrophenyl)hydrazinylidene]pyrrolidin-2-one |
| SMILES | CN1C(=O)C(=N/Nc2ccccc2[N+](=O)[O-])/C(=N/O)C1(C)C |
| InChI | InChI=1S/C13H15N5O4/c1-13(2)11(16-20)10(12(19)17(13)3)15-14-8-6-4-5-7-9(8)18(21)22/h4-7,14,20H,1-3H3/b15-10+,16-11- |
| InChIKey | PGIXHBUNQIAKJM-AXOLISODSA-N |
| XLogP | 1.44 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|