C15H19N3O2 — CID 4592414
2-nitro-N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]aniline (PubChem CID 4592414) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-nitro-N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]aniline.
| Compound Name | 2-nitro-N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]aniline |
|---|---|
| PubChem CID | 4592414 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-nitro-N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]aniline |
| SMILES | CC1=CC(=NNc2ccccc2[N+](=O)[O-])CC(C)(C)C1 |
| InChI | InChI=1S/C15H19N3O2/c1-11-8-12(10-15(2,3)9-11)16-17-13-6-4-5-7-14(13)18(19)20/h4-8,17H,9-10H2,1-3H3 |
| InChIKey | NQSCBKIUPMTLEE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|