C27H20N4O4 — CID 98526847
N-[(Z)-[(2Z)-2-(naphthalen-1-ylmethylidene)-3,4-dihydronaphthalen-1-ylidene]amino]-2,4-dinitroaniline (PubChem CID 98526847) has the molecular formula C27H20N4O4 and a molecular weight of 464.48 g/mol. Its IUPAC name is N-[(Z)-[(2Z)-2-(naphthalen-1-ylmethylidene)-3,4-dihydronaphthalen-1-ylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-[(2Z)-2-(naphthalen-1-ylmethylidene)-3,4-dihydronaphthalen-1-ylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 98526847 |
| Molecular Formula | C27H20N4O4 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[(Z)-[(2Z)-2-(naphthalen-1-ylmethylidene)-3,4-dihydronaphthalen-1-ylidene]amino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C2C(=C\c3cccc4ccccc34)/CCc3ccccc3/2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H20N4O4/c32-30(33)22-14-15-25(26(17-22)31(34)35)28-29-27-21(13-12-19-7-2-4-11-24(19)27)16-20-9-5-8-18-6-1-3-10-23(18)20/h1-11,14-17,28H,12-13H2/b21-16-,29-27- |
| InChIKey | NKTZDNMXXDMMGF-CLIBWDEDSA-N |
| XLogP | 6.50 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|