C20H16N4O4 — CID 592493
N-[1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]-2,4-dinitroaniline (PubChem CID 592493) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is N-[1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 592493 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]-2,4-dinitroaniline |
| SMILES | CC(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C20H16N4O4/c1-12(16-9-7-14-6-5-13-3-2-4-17(16)20(13)14)21-22-18-10-8-15(23(25)26)11-19(18)24(27)28/h2-4,7-11,22H,5-6H2,1H3 |
| InChIKey | FLDKFOKGYYDZQK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|