C15H18N4O6 — CID 5149855
methyl 2-[4-[(2,4-dinitrophenyl)hydrazinylidene]cyclohexyl]acetate (PubChem CID 5149855) has the molecular formula C15H18N4O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is methyl 2-[4-[(2,4-dinitrophenyl)hydrazinylidene]cyclohexyl]acetate.
| Compound Name | methyl 2-[4-[(2,4-dinitrophenyl)hydrazinylidene]cyclohexyl]acetate |
|---|---|
| PubChem CID | 5149855 |
| Molecular Formula | C15H18N4O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | methyl 2-[4-[(2,4-dinitrophenyl)hydrazinylidene]cyclohexyl]acetate |
| SMILES | COC(=O)CC1CCC(=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H18N4O6/c1-25-15(20)8-10-2-4-11(5-3-10)16-17-13-7-6-12(18(21)22)9-14(13)19(23)24/h6-7,9-10,17H,2-5,8H2,1H3/b16-11- |
| InChIKey | KELZXWVWWJBFSL-WJDWOHSUSA-N |
| XLogP | 3.02 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|