C22H26N4O6 — CID 2749616
N-[[2-(4-methoxycyclohexyl)-1-(4-methoxyphenyl)ethylidene]amino]-2,4-dinitroaniline (PubChem CID 2749616) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is N-[[2-(4-methoxycyclohexyl)-1-(4-methoxyphenyl)ethylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[[2-(4-methoxycyclohexyl)-1-(4-methoxyphenyl)ethylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 2749616 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-[[2-(4-methoxycyclohexyl)-1-(4-methoxyphenyl)ethylidene]amino]-2,4-dinitroaniline |
| SMILES | COc1ccc(C(CC2CCC(OC)CC2)=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H26N4O6/c1-31-18-8-3-15(4-9-18)13-21(16-5-10-19(32-2)11-6-16)24-23-20-12-7-17(25(27)28)14-22(20)26(29)30/h5-7,10-12,14-15,18,23H,3-4,8-9,13H2,1-2H3 |
| InChIKey | HICAHQYAQPLREC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|