C16H18N4O5 — CID 7722150
(3S,5S)-4-[(2,4-dinitrophenyl)hydrazinylidene]adamantan-1-ol (PubChem CID 7722150) has the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is (3S,5S)-4-[(2,4-dinitrophenyl)hydrazinylidene]adamantan-1-ol.
| Compound Name | (3S,5S)-4-[(2,4-dinitrophenyl)hydrazinylidene]adamantan-1-ol |
|---|---|
| PubChem CID | 7722150 |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (3S,5S)-4-[(2,4-dinitrophenyl)hydrazinylidene]adamantan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(NN=C2[C@H]3CC4C[C@H]2CC(O)(C4)C3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H18N4O5/c21-16-6-9-3-10(7-16)15(11(4-9)8-16)18-17-13-2-1-12(19(22)23)5-14(13)20(24)25/h1-2,5,9-11,17,21H,3-4,6-8H2/b18-15-/t9?,10-,11-,16?/m0/s1 |
| InChIKey | QIGAXIMBSIOSMJ-IFJYXNEGSA-N |
| XLogP | 2.84 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|