C18H23N3O4 — CID 7325101
N-[(1S)-1-(1-adamantyl)ethyl]-2,4-dinitroaniline (PubChem CID 7325101) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-2,4-dinitroaniline.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 7325101 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-2,4-dinitroaniline |
| SMILES | C[C@H](Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H23N3O4/c1-11(18-8-12-4-13(9-18)6-14(5-12)10-18)19-16-3-2-15(20(22)23)7-17(16)21(24)25/h2-3,7,11-14,19H,4-6,8-10H2,1H3/t11-,12?,13?,14?,18?/m0/s1 |
| InChIKey | QWFBYWVZTWTDGR-IWERZKIRSA-N |
| XLogP | 4.52 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|