C19H25N3O2S — CID 8614552
1-[(1R)-1-(1-adamantyl)ethyl]-3-(4-nitrophenyl)thiourea (PubChem CID 8614552) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-[(1R)-1-(1-adamantyl)ethyl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[(1R)-1-(1-adamantyl)ethyl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 8614552 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-[(1R)-1-(1-adamantyl)ethyl]-3-(4-nitrophenyl)thiourea |
| SMILES | C[C@@H](NC(=S)Nc1ccc([N+](=O)[O-])cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H25N3O2S/c1-12(19-9-13-6-14(10-19)8-15(7-13)11-19)20-18(25)21-16-2-4-17(5-3-16)22(23)24/h2-5,12-15H,6-11H2,1H3,(H2,20,21,25)/t12-,13?,14?,15?,19?/m1/s1 |
| InChIKey | BXRBRVMUOGCFIA-XUXNNNHQSA-N |
| XLogP | 4.49 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|