C19H27N3O2S2 — CID 19651629
1-[1-(1-adamantyl)ethyl]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 19651629) has the molecular formula C19H27N3O2S2 and a molecular weight of 393.58 g/mol. Its IUPAC name is 1-[1-(1-adamantyl)ethyl]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[1-(1-adamantyl)ethyl]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 19651629 |
| Molecular Formula | C19H27N3O2S2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 1-[1-(1-adamantyl)ethyl]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | CC(NC(=S)Nc1ccc(S(N)(=O)=O)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H27N3O2S2/c1-12(19-9-13-6-14(10-19)8-15(7-13)11-19)21-18(25)22-16-2-4-17(5-3-16)26(20,23)24/h2-5,12-15H,6-11H2,1H3,(H2,20,23,24)(H2,21,22,25) |
| InChIKey | NFWWIAQRADETLO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|