C20H29N3O3S — CID 8512183
(2S)-2-(1-adamantylmethylamino)-N-(4-sulfamoylphenyl)propanamide (PubChem CID 8512183) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is (2S)-2-(1-adamantylmethylamino)-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | (2S)-2-(1-adamantylmethylamino)-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 8512183 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (2S)-2-(1-adamantylmethylamino)-N-(4-sulfamoylphenyl)propanamide |
| SMILES | C[C@H](NCC12CC3CC(CC(C3)C1)C2)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H29N3O3S/c1-13(19(24)23-17-2-4-18(5-3-17)27(21,25)26)22-12-20-9-14-6-15(10-20)8-16(7-14)11-20/h2-5,13-16,22H,6-12H2,1H3,(H,23,24)(H2,21,25,26)/t13-,14?,15?,16?,20?/m0/s1 |
| InChIKey | NLOULGGMAYWCKY-IVKJLDKCSA-N |
| XLogP | 2.47 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |