C20H27N3O2 — CID 9358575
4-[[(2R)-2-(1-adamantylamino)propanoyl]amino]benzamide (PubChem CID 9358575) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 4-[[(2R)-2-(1-adamantylamino)propanoyl]amino]benzamide.
| Compound Name | 4-[[(2R)-2-(1-adamantylamino)propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 9358575 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 4-[[(2R)-2-(1-adamantylamino)propanoyl]amino]benzamide |
| SMILES | C[C@@H](NC12CC3CC(CC(C3)C1)C2)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C20H27N3O2/c1-12(19(25)22-17-4-2-16(3-5-17)18(21)24)23-20-9-13-6-14(10-20)8-15(7-13)11-20/h2-5,12-15,23H,6-11H2,1H3,(H2,21,24)(H,22,25)/t12-,13?,14?,15?,20?/m1/s1 |
| InChIKey | MFQIJWXKNBLPBR-JSFDKUKPSA-N |
| XLogP | 2.67 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |