C22H32N2O — CID 84990626
2-(1-adamantylamino)-N-(4-propan-2-ylphenyl)propanamide (PubChem CID 84990626) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is 2-(1-adamantylamino)-N-(4-propan-2-ylphenyl)propanamide.
| Compound Name | 2-(1-adamantylamino)-N-(4-propan-2-ylphenyl)propanamide |
|---|---|
| PubChem CID | 84990626 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 2-(1-adamantylamino)-N-(4-propan-2-ylphenyl)propanamide |
| SMILES | CC(NC12CC3CC(CC(C3)C1)C2)C(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H32N2O/c1-14(2)19-4-6-20(7-5-19)23-21(25)15(3)24-22-11-16-8-17(12-22)10-18(9-16)13-22/h4-7,14-18,24H,8-13H2,1-3H3,(H,23,25) |
| InChIKey | CPCJSPZDJDOXIB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |