C16H20N4O5S2 — CID 2455935
(2R)-N-(4-sulfamoylphenyl)-2-[(4-sulfamoylphenyl)methylamino]propanamide (PubChem CID 2455935) has the molecular formula C16H20N4O5S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is (2R)-N-(4-sulfamoylphenyl)-2-[(4-sulfamoylphenyl)methylamino]propanamide.
| Compound Name | (2R)-N-(4-sulfamoylphenyl)-2-[(4-sulfamoylphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 2455935 |
| Molecular Formula | C16H20N4O5S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (2R)-N-(4-sulfamoylphenyl)-2-[(4-sulfamoylphenyl)methylamino]propanamide |
| SMILES | C[C@@H](NCc1ccc(S(N)(=O)=O)cc1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H20N4O5S2/c1-11(19-10-12-2-6-14(7-3-12)26(17,22)23)16(21)20-13-4-8-15(9-5-13)27(18,24)25/h2-9,11,19H,10H2,1H3,(H,20,21)(H2,17,22,23)(H2,18,24,25)/t11-/m1/s1 |
| InChIKey | SIAKKZIRIUJQEM-LLVKDONJSA-N |
| XLogP | 0.10 |
| TPSA | 161.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |