C16H18N2O5S — CID 84578792
3-(3,4-dihydroxyphenyl)-2-methyl-N-(4-sulfamoylphenyl)propanamide (PubChem CID 84578792) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-methyl-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-methyl-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 84578792 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-methyl-N-(4-sulfamoylphenyl)propanamide |
| SMILES | CC(Cc1ccc(O)c(O)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H18N2O5S/c1-10(8-11-2-7-14(19)15(20)9-11)16(21)18-12-3-5-13(6-4-12)24(17,22)23/h2-7,9-10,19-20H,8H2,1H3,(H,18,21)(H2,17,22,23) |
| InChIKey | UNEBAIWQYKOGPD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|