C24H29N3O4S2 — CID 7060188
N-[[4-[[(1R)-1-(1-adamantyl)ethyl]sulfamoyl]phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 7060188) has the molecular formula C24H29N3O4S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is N-[[4-[[(1R)-1-(1-adamantyl)ethyl]sulfamoyl]phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[4-[[(1R)-1-(1-adamantyl)ethyl]sulfamoyl]phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 7060188 |
| Molecular Formula | C24H29N3O4S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | N-[[4-[[(1R)-1-(1-adamantyl)ethyl]sulfamoyl]phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccco2)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H29N3O4S2/c1-15(24-12-16-9-17(13-24)11-18(10-16)14-24)27-33(29,30)20-6-4-19(5-7-20)25-23(32)26-22(28)21-3-2-8-31-21/h2-8,15-18,27H,9-14H2,1H3,(H2,25,26,28,32)/t15-,16?,17?,18?,24?/m1/s1 |
| InChIKey | GYEHRICDHYLHME-LJQCHSNASA-N |
| XLogP | 4.29 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|