C17H18N2O4S — CID 19187791
2-methylpropyl 4-(furan-2-carbonylcarbamothioylamino)benzoate (PubChem CID 19187791) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-methylpropyl 4-(furan-2-carbonylcarbamothioylamino)benzoate.
| Compound Name | 2-methylpropyl 4-(furan-2-carbonylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 19187791 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-methylpropyl 4-(furan-2-carbonylcarbamothioylamino)benzoate |
| SMILES | CC(C)COC(=O)c1ccc(NC(=S)NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-11(2)10-23-16(21)12-5-7-13(8-6-12)18-17(24)19-15(20)14-4-3-9-22-14/h3-9,11H,10H2,1-2H3,(H2,18,19,20,24) |
| InChIKey | YSHJTRGRFGYFOH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|