C15H24N2O3 — CID 7297610
2-methylpropyl N-(furan-2-carbonyl)-N'-(3-methylbutyl)carbamimidate (PubChem CID 7297610) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-methylpropyl N-(furan-2-carbonyl)-N'-(3-methylbutyl)carbamimidate.
| Compound Name | 2-methylpropyl N-(furan-2-carbonyl)-N'-(3-methylbutyl)carbamimidate |
|---|---|
| PubChem CID | 7297610 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-methylpropyl N-(furan-2-carbonyl)-N'-(3-methylbutyl)carbamimidate |
| SMILES | CC(C)CC/N=C(/NC(=O)c1ccco1)OCC(C)C |
| InChI | InChI=1S/C15H24N2O3/c1-11(2)7-8-16-15(20-10-12(3)4)17-14(18)13-6-5-9-19-13/h5-6,9,11-12H,7-8,10H2,1-4H3,(H,16,17,18) |
| InChIKey | JBLYDVSLZAZGNE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|